Difference between revisions of "Poly-Gamma-Glutamylcysteine-Glycines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17067 RXN-17067] == * direction: ** left-to-right * common-name: ** phenoxazinone synthase * ec...")
(Created page with "Category:metabolite == Metabolite CPD-374 == * common-name: ** sepiapterin * smiles: ** cc(o)c(=o)c1(cnc2(n=c(n)nc(=o)c(n=1)=2)) * inchi-key: ** vpvoxuspxfpwbn-vkhmyheasa-...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17067 RXN-17067] ==
+
== Metabolite CPD-374 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** phenoxazinone synthase
+
** sepiapterin
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.10.3.4 ec-1.10.3.4]
+
** cc(o)c(=o)c1(cnc2(n=c(n)nc(=o)c(n=1)=2))
−
== Reaction formula ==
+
* inchi-key:
−
* 4 [[CPD-18437]][c] '''+''' 3 [[OXYGEN-MOLECULE]][c] '''=>''' 2 [[ACTINOMYCIN-D]][c] '''+''' 6 [[WATER]][c]
+
** vpvoxuspxfpwbn-vkhmyheasa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ09941]]
+
** 237.218
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[SEPIAPTERIN-REDUCTASE-RXN]]
−
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
−
* [[PWY-7718]], actinomycin D biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7718 PWY-7718]
+
* [[SEPIAPTERIN-REDUCTASE-RXN]]
−
** '''1''' reactions found over '''5''' reactions in the full pathway
+
== Reaction(s) of unknown directionality ==
−
== Reconstruction information  ==
+
{{#set: common-name=sepiapterin}}
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=vpvoxuspxfpwbn-vkhmyheasa-n}}
−
== External links  ==
+
{{#set: molecular-weight=237.218}}
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=phenoxazinone synthase}}
 
−
{{#set: ec-number=ec-1.10.3.4}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:35, 18 December 2020

Metabolite CPD-374

  • common-name:
    • sepiapterin
  • smiles:
    • cc(o)c(=o)c1(cnc2(n=c(n)nc(=o)c(n=1)=2))
  • inchi-key:
    • vpvoxuspxfpwbn-vkhmyheasa-n
  • molecular-weight:
    • 237.218

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=Poly-Gamma-Glutamylcysteine-Glycines&oldid=47706"