Difference between revisions of "Poly-Gamma-Glutamylcysteine-Glycines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-374 == * common-name: ** sepiapterin * smiles: ** cc(o)c(=o)c1(cnc2(n=c(n)nc(=o)c(n=1)=2)) * inchi-key: ** vpvoxuspxfpwbn-vkhmyheasa-...")
(Created page with "Category:metabolite == Metabolite CPD-18319 == * common-name: ** n-3-(r,r)-epoxysuccinamoyl-(s)-2,3-diaminopropanoate * smiles: ** c(nc(=o)c1(oc(c(=o)n)1))c([n+])c(=o)[o-]...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-374 ==
+
== Metabolite CPD-18319 ==
 
* common-name:
 
* common-name:
** sepiapterin
+
** n-3-(r,r)-epoxysuccinamoyl-(s)-2,3-diaminopropanoate
 
* smiles:
 
* smiles:
** cc(o)c(=o)c1(cnc2(n=c(n)nc(=o)c(n=1)=2))
+
** c(nc(=o)c1(oc(c(=o)n)1))c([n+])c(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** vpvoxuspxfpwbn-vkhmyheasa-n
+
** lqrxqgmibgpnby-pzgqecojsa-n
 
* molecular-weight:
 
* molecular-weight:
** 237.218
+
** 217.181
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[SEPIAPTERIN-REDUCTASE-RXN]]
+
* [[RXN-16991]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[SEPIAPTERIN-REDUCTASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=sepiapterin}}
+
{{#set: common-name=n-3-(r,r)-epoxysuccinamoyl-(s)-2,3-diaminopropanoate}}
{{#set: inchi-key=inchikey=vpvoxuspxfpwbn-vkhmyheasa-n}}
+
{{#set: inchi-key=inchikey=lqrxqgmibgpnby-pzgqecojsa-n}}
{{#set: molecular-weight=237.218}}
+
{{#set: molecular-weight=217.181}}

Revision as of 14:58, 5 January 2021

Metabolite CPD-18319

  • common-name:
    • n-3-(r,r)-epoxysuccinamoyl-(s)-2,3-diaminopropanoate
  • smiles:
    • c(nc(=o)c1(oc(c(=o)n)1))c([n+])c(=o)[o-]
  • inchi-key:
    • lqrxqgmibgpnby-pzgqecojsa-n
  • molecular-weight:
    • 217.181

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality