Difference between revisions of "Poly-Hydroxybutyrate"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 5-HYDROXY-CONIFERALDEHYDE == * common-name: ** 5-hydroxy-coniferaldehyde * smiles: ** coc1(=cc(c=cc=o)=cc(o)=c(o)1) * inchi-key: ** iehpl...") |
(Created page with "Category:metabolite == Metabolite Poly-Hydroxybutyrate == * common-name: ** poly-3-hydroxybutanoate == Reaction(s) known to consume the compound == * 3.1.1.75-RXN == R...") |
||
| (3 intermediate revisions by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Poly-Hydroxybutyrate == |
* common-name: | * common-name: | ||
| − | ** | + | ** poly-3-hydroxybutanoate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[3.1.1.75-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[3.1.1.75-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=poly-3-hydroxybutanoate}} |
| − | |||
| − | |||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite Poly-Hydroxybutyrate
- common-name:
- poly-3-hydroxybutanoate
