Difference between revisions of "Poly-Hydroxybutyrate"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 5-HYDROXY-CONIFERALDEHYDE == * common-name: ** 5-hydroxy-coniferaldehyde * smiles: ** coc1(=cc(c=cc=o)=cc(o)=c(o)1) * inchi-key: ** iehpl...") |
(Created page with "Category:metabolite == Metabolite Charged-TRP-tRNAs == * common-name: ** an l-tryptophanyl-[trnatrp] == Reaction(s) known to consume the compound == == Reaction(s) known t...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Charged-TRP-tRNAs == |
* common-name: | * common-name: | ||
− | ** | + | ** an l-tryptophanyl-[trnatrp] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[TRYPTOPHAN--TRNA-LIGASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=an l-tryptophanyl-[trnatrp]}} |
− | |||
− |
Revision as of 18:54, 14 January 2021
Contents
Metabolite Charged-TRP-tRNAs
- common-name:
- an l-tryptophanyl-[trnatrp]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an l-tryptophanyl-[trnatrp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.