Difference between revisions of "Poly-beta-D-Mannuronate"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Mitogen-Activated-Protein-Kinase-L-Thr == * common-name: ** a [mitogen-activated protein kinase]-l-threonine == Reaction(s) known to cons...")
(Created page with "Category:metabolite == Metabolite PARATHION == * common-name: ** parathion * smiles: ** ccop(oc1(c=cc(=cc=1)[n+](=o)[o-]))(occ)=s * inchi-key: ** lccncvornkjirz-uhfffaoysa...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Mitogen-Activated-Protein-Kinase-L-Thr ==
+
== Metabolite PARATHION ==
 
* common-name:
 
* common-name:
** a [mitogen-activated protein kinase]-l-threonine
+
** parathion
 +
* smiles:
 +
** ccop(oc1(c=cc(=cc=1)[n+](=o)[o-]))(occ)=s
 +
* inchi-key:
 +
** lccncvornkjirz-uhfffaoysa-n
 +
* molecular-weight:
 +
** 291.258
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.12.2-RXN]]
+
* [[ARYLDIALKYL-PHOSPHATASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.12.2-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [mitogen-activated protein kinase]-l-threonine}}
+
{{#set: common-name=parathion}}
 +
{{#set: inchi-key=inchikey=lccncvornkjirz-uhfffaoysa-n}}
 +
{{#set: molecular-weight=291.258}}

Revision as of 11:15, 15 January 2021

Metabolite PARATHION

  • common-name:
    • parathion
  • smiles:
    • ccop(oc1(c=cc(=cc=1)[n+](=o)[o-]))(occ)=s
  • inchi-key:
    • lccncvornkjirz-uhfffaoysa-n
  • molecular-weight:
    • 291.258

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality