Difference between revisions of "Poly-beta-D-Mannuronate"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PARATHION == * common-name: ** parathion * smiles: ** ccop(oc1(c=cc(=cc=1)[n+](=o)[o-]))(occ)=s * inchi-key: ** lccncvornkjirz-uhfffaoysa...") |
(Created page with "Category:metabolite == Metabolite Poly-beta-D-Mannuronate == * common-name: ** mannuronan == Reaction(s) known to consume the compound == * RXN-9839 == Reaction(s) kno...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Poly-beta-D-Mannuronate == |
* common-name: | * common-name: | ||
− | ** | + | ** mannuronan |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-9839]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[ALGINATE-SYNTHASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=mannuronan}} |
− | |||
− |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite Poly-beta-D-Mannuronate
- common-name:
- mannuronan