Difference between revisions of "Poly-beta-D-Mannuronate"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PARATHION == * common-name: ** parathion * smiles: ** ccop(oc1(c=cc(=cc=1)[n+](=o)[o-]))(occ)=s * inchi-key: ** lccncvornkjirz-uhfffaoysa...")
(Created page with "Category:metabolite == Metabolite Poly-beta-D-Mannuronate == * common-name: ** mannuronan == Reaction(s) known to consume the compound == * RXN-9839 == Reaction(s) kno...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PARATHION ==
+
== Metabolite Poly-beta-D-Mannuronate ==
 
* common-name:
 
* common-name:
** parathion
+
** mannuronan
* smiles:
 
** ccop(oc1(c=cc(=cc=1)[n+](=o)[o-]))(occ)=s
 
* inchi-key:
 
** lccncvornkjirz-uhfffaoysa-n
 
* molecular-weight:
 
** 291.258
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ARYLDIALKYL-PHOSPHATASE-RXN]]
+
* [[RXN-9839]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[ALGINATE-SYNTHASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=parathion}}
+
{{#set: common-name=mannuronan}}
{{#set: inchi-key=inchikey=lccncvornkjirz-uhfffaoysa-n}}
 
{{#set: molecular-weight=291.258}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite Poly-beta-D-Mannuronate

  • common-name:
    • mannuronan

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality