Difference between revisions of "Poly-beta-D-Mannuronate"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PARATHION == * common-name: ** parathion * smiles: ** ccop(oc1(c=cc(=cc=1)[n+](=o)[o-]))(occ)=s * inchi-key: ** lccncvornkjirz-uhfffaoysa...")
(Created page with "Category:metabolite == Metabolite L-arginyl-L-Glutamyl-Peptides == * common-name: ** an n-terminal l-arginiyl-l-glutamyl-[protein] == Reaction(s) known to consume the comp...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PARATHION ==
+
== Metabolite L-arginyl-L-Glutamyl-Peptides ==
 
* common-name:
 
* common-name:
** parathion
+
** an n-terminal l-arginiyl-l-glutamyl-[protein]
* smiles:
 
** ccop(oc1(c=cc(=cc=1)[n+](=o)[o-]))(occ)=s
 
* inchi-key:
 
** lccncvornkjirz-uhfffaoysa-n
 
* molecular-weight:
 
** 291.258
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ARYLDIALKYL-PHOSPHATASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-17888]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=parathion}}
+
{{#set: common-name=an n-terminal l-arginiyl-l-glutamyl-[protein]}}
{{#set: inchi-key=inchikey=lccncvornkjirz-uhfffaoysa-n}}
 
{{#set: molecular-weight=291.258}}
 

Revision as of 15:26, 5 January 2021

Metabolite L-arginyl-L-Glutamyl-Peptides

  • common-name:
    • an n-terminal l-arginiyl-l-glutamyl-[protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an n-terminal l-arginiyl-l-glutamyl-[protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.