Difference between revisions of "Poly-beta-D-Mannuronate"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite N-ACETYL-5-METHOXY-TRYPTAMINE == * common-name: ** melatonin * smiles: ** cc(=o)nccc2(=cnc1(=c(c=c(oc)c=c1)2)) * inchi-key: ** drlfmbdrbr...") |
(Created page with "Category:metabolite == Metabolite Mitogen-Activated-Protein-Kinase-L-Thr == * common-name: ** a [mitogen-activated protein kinase]-l-threonine == Reaction(s) known to cons...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Mitogen-Activated-Protein-Kinase-L-Thr == |
* common-name: | * common-name: | ||
| − | ** | + | ** a [mitogen-activated protein kinase]-l-threonine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[2.7.12.2-RXN]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[2.7.12.2-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a [mitogen-activated protein kinase]-l-threonine}} |
| − | |||
| − | |||
Revision as of 18:54, 14 January 2021
Contents
Metabolite Mitogen-Activated-Protein-Kinase-L-Thr
- common-name:
- a [mitogen-activated protein kinase]-l-threonine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [mitogen-activated protein kinase]-l-threonine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
