Difference between revisions of "Polyamines"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DCDP == * common-name: ** dcdp * smiles: ** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op(op(=o)([o-])[o-])([o-])=o * inchi-key: ** ftdhdkpuhblb...") |
(Created page with "Category:metabolite == Metabolite Polyamines == * common-name: ** a polyamine == Reaction(s) known to consume the compound == * 3.6.3.31-RXN == Reaction(s) known to pr...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Polyamines == |
* common-name: | * common-name: | ||
| − | ** | + | ** a polyamine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[3.6.3.31-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[3.6.3.31-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a polyamine}} |
| − | |||
| − | |||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite Polyamines
- common-name:
- a polyamine
