Difference between revisions of "Polyamines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ACETONE == * common-name: ** acetone * smiles: ** cc(=o)c * inchi-key: ** cscppacgzoocgx-uhfffaoysa-n * molecular-weight: ** 58.08 == Rea...")
(Created page with "Category:metabolite == Metabolite CPD-9245 == * common-name: ** palmitoleate * smiles: ** ccccccc=ccccccccc(=o)[o-] * inchi-key: ** secpzkhbenqxjg-fplpwbnlsa-m * molecular...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ACETONE ==
+
== Metabolite CPD-9245 ==
 
* common-name:
 
* common-name:
** acetone
+
** palmitoleate
 
* smiles:
 
* smiles:
** cc(=o)c
+
** ccccccc=ccccccccc(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** cscppacgzoocgx-uhfffaoysa-n
+
** secpzkhbenqxjg-fplpwbnlsa-m
 
* molecular-weight:
 
* molecular-weight:
** 58.08
+
** 253.404
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8630]]
+
* [[RXN0-7248]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-10662]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=acetone}}
+
{{#set: common-name=palmitoleate}}
{{#set: inchi-key=inchikey=cscppacgzoocgx-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=secpzkhbenqxjg-fplpwbnlsa-m}}
{{#set: molecular-weight=58.08}}
+
{{#set: molecular-weight=253.404}}

Revision as of 18:54, 14 January 2021

Metabolite CPD-9245

  • common-name:
    • palmitoleate
  • smiles:
    • ccccccc=ccccccccc(=o)[o-]
  • inchi-key:
    • secpzkhbenqxjg-fplpwbnlsa-m
  • molecular-weight:
    • 253.404

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality