Difference between revisions of "PppGp-his-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12303 == * common-name: ** undecaprenyl-diphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-l-lysyl- d-alanine * smiles: ** cc(c)=...")
(Created page with "Category:metabolite == Metabolite pppGp-his-tRNAs == * common-name: ** 5'-triphospho-guanosine-ribonucleotide-[trnahis] == Reaction(s) known to consume the compound == ==...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12303 ==
+
== Metabolite pppGp-his-tRNAs ==
 
* common-name:
 
* common-name:
** undecaprenyl-diphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-l-lysyl- d-alanine
+
** 5'-triphospho-guanosine-ribonucleotide-[trnahis]
* smiles:
 
** cc(c)=cccc(c)=cccc(c)=cccc(=cccc(=cccc(=cccc(c)=cccc(=cccc(=cccc(=cccc(=ccop(op([o-])(=o)oc1(c(nc(=o)c)c(oc(c)c(=o)nc(c)c(=o)nc(c(=o)[o-])ccc(=o)nc(cccc[n+])c(nc(c)c(=o)[o-])=o)c(o)c(co)o1))([o-])=o)c)c)c)c)c)c)c
 
* inchi-key:
 
** kcrofjgxxschga-ygmfixcysa-k
 
* molecular-weight:
 
** 1598.955
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11347]]
+
* [[RXN-12502]]
 +
* [[RXN-12504]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=undecaprenyl-diphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-l-lysyl- d-alanine}}
+
{{#set: common-name=5'-triphospho-guanosine-ribonucleotide-[trnahis]}}
{{#set: inchi-key=inchikey=kcrofjgxxschga-ygmfixcysa-k}}
 
{{#set: molecular-weight=1598.955}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite pppGp-his-tRNAs

  • common-name:
    • 5'-triphospho-guanosine-ribonucleotide-[trnahis]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "5'-triphospho-guanosine-ribonucleotide-[trnahis" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.