Difference between revisions of "Primary-Alcohols"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ13394 == * transcription-direction: ** negative * right-end-position: ** 182566 * left-end-position: ** 146362 * centisome-position: ** 43.290455...")
(Created page with "Category:metabolite == Metabolite CPD-19171 == * common-name: ** (s)-3-hydroxy-(9z)-octadecenoyl-coa * smiles: ** ccccccccc=ccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ13394 ==
+
== Metabolite CPD-19171 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** (s)-3-hydroxy-(9z)-octadecenoyl-coa
−
* right-end-position:
+
* smiles:
−
** 182566
+
** ccccccccc=ccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
−
* left-end-position:
+
* inchi-key:
−
** 146362
+
** lhayytcfpmuqnr-dfxypyghsa-j
−
* centisome-position:
+
* molecular-weight:
−
** 43.290455   
+
** 1043.952
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-17777]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[GALACTOSYLCERAMIDE-SULFOTRANSFERASE-RXN]]
+
* [[RXN-17776]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=(s)-3-hydroxy-(9z)-octadecenoyl-coa}}
−
** Category: [[orthology]]
+
{{#set: inchi-key=inchikey=lhayytcfpmuqnr-dfxypyghsa-j}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=1043.952}}
−
* [[RXN-17203]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-18301]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-18303]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-7840]]
 
−
** '''3''' reactions found over '''5''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=182566}}
 
−
{{#set: left-end-position=146362}}
 
−
{{#set: centisome-position=43.290455    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=4}}
 
−
{{#set: nb pathway associated=1}}
 

Revision as of 20:31, 18 December 2020

Metabolite CPD-19171

  • common-name:
    • (s)-3-hydroxy-(9z)-octadecenoyl-coa
  • smiles:
    • ccccccccc=ccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • lhayytcfpmuqnr-dfxypyghsa-j
  • molecular-weight:
    • 1043.952

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=Primary-Alcohols&oldid=46039"