Difference between revisions of "Primary-Amines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DOPAMINE == * common-name: ** dopamine * smiles: ** c(cc1(c=c(c(=cc=1)o)o))[n+] * inchi-key: ** vyfyytllbukuhu-uhfffaoysa-o * molecular-w...")
(Created page with "Category:metabolite == Metabolite CPD-18888 == * smiles: ** cc=c5(c(c)c9(n6([mg]27(n1(c(c(c)c(ccc(=o)occ=c(c)cccc(c)cccc(c)ccc=c(c)c)c=1c4([c-](c(oc)=o)c(=o)c3(=c(c)c(n2c3...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DOPAMINE ==
+
== Metabolite CPD-18888 ==
 +
* smiles:
 +
** cc=c5(c(c)c9(n6([mg]27(n1(c(c(c)c(ccc(=o)occ=c(c)cccc(c)cccc(c)ccc=c(c)c)c=1c4([c-](c(oc)=o)c(=o)c3(=c(c)c(n2c3=4)=cc5=6)))=cc8(=c(c)c(c(c)=o)=c(n78)c=9))))))
 
* common-name:
 
* common-name:
** dopamine
+
** tetrahydrogeranylgeranyl bacteriochlorophyllide b
* smiles:
 
** c(cc1(c=c(c(=cc=1)o)o))[n+]
 
* inchi-key:
 
** vyfyytllbukuhu-uhfffaoysa-o
 
 
* molecular-weight:
 
* molecular-weight:
** 154.188
+
** 906.478
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DOPAMINE-BETA-MONOOXYGENASE-RXN]]
+
* [[RXN-17482]]
* [[RXN6666-4]]
 
* [[RXN6666-9]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN66-221]]
+
* [[RXN-17484]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dopamine}}
+
{{#set: common-name=tetrahydrogeranylgeranyl bacteriochlorophyllide b}}
{{#set: inchi-key=inchikey=vyfyytllbukuhu-uhfffaoysa-o}}
+
{{#set: molecular-weight=906.478}}
{{#set: molecular-weight=154.188}}
 

Revision as of 08:28, 15 March 2021

Metabolite CPD-18888

  • smiles:
    • cc=c5(c(c)c9(n6([mg]27(n1(c(c(c)c(ccc(=o)occ=c(c)cccc(c)cccc(c)ccc=c(c)c)c=1c4([c-](c(oc)=o)c(=o)c3(=c(c)c(n2c3=4)=cc5=6)))=cc8(=c(c)c(c(c)=o)=c(n78)c=9))))))
  • common-name:
    • tetrahydrogeranylgeranyl bacteriochlorophyllide b
  • molecular-weight:
    • 906.478

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality