Difference between revisions of "Primary-Amines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-321 RXN66-321] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/...")
(Created page with "Category:metabolite == Metabolite SPERMINE == * common-name: ** spermine * smiles: ** c(ccc[n+]ccc[n+])[n+]ccc[n+] * inchi-key: ** pfnffqxmrsdohw-uhfffaoysa-r * molecular-...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-321 RXN66-321] ==
+
== Metabolite SPERMINE ==
−
* direction:
+
* common-name:
−
** left-to-right
+
** spermine
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.3.1.72 ec-1.3.1.72]
+
** c(ccc[n+]ccc[n+])[n+]ccc[n+]
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[5-ALPHA-CHOLESTA-724-DIEN-3-BETA-OL]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CPD-4186]][c] '''+''' 1 [[NADP]][c]
+
** pfnffqxmrsdohw-uhfffaoysa-r
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
== Pathway(s) ==
+
** 206.374
−
* [[PWY66-341]], cholesterol biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-341 PWY66-341]
+
== Reaction(s) known to consume the compound ==
−
** '''14''' reactions found over '''18''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
−
== Reconstruction information  ==
+
* [[SPERMINE-SYNTHASE-RXN]]
−
* category: [[gap-filling]]; source: [[gapfilling_solution_with_meneco_draft_medium]]; tool: [[meneco]]; comment: added for gapfilling
+
== Reaction(s) of unknown directionality ==
−
== External links  ==
+
{{#set: common-name=spermine}}
−
* LIGAND-RXN:
+
{{#set: inchi-key=inchikey=pfnffqxmrsdohw-uhfffaoysa-r}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R05703 R05703]
+
{{#set: molecular-weight=206.374}}
−
{{#set: direction=left-to-right}}
 
−
{{#set: ec-number=ec-1.3.1.72}}
 
−
{{#set: nb gene associated=0}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=gap-filling}}
 
−
{{#set: reconstruction tool=meneco}}
 
−
{{#set: reconstruction comment=added for gapfilling}}
 
−
{{#set: reconstruction source=gapfilling_solution_with_meneco_draft_medium}}
 

Revision as of 20:34, 18 December 2020

Metabolite SPERMINE

  • common-name:
    • spermine
  • smiles:
    • c(ccc[n+]ccc[n+])[n+]ccc[n+]
  • inchi-key:
    • pfnffqxmrsdohw-uhfffaoysa-r
  • molecular-weight:
    • 206.374

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=Primary-Amines&oldid=47375"