Difference between revisions of "Pro-tRNA-2-O-MeCytidine4"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite HMP == * common-name: ** 4-amino-2-methyl-5-pyrimidinemethanol * smiles: ** cc1(n=c(c(=cn=1)co)n) * inchi-key: ** vutbelpredjddh-uhfffaoy...")
(Created page with "Category:metabolite == Metabolite 4-CARBOXYMETHYLENEBUT-2-EN-4-OLIDE == * common-name: ** cis-dienelactone * smiles: ** c1(=cc(=o)oc(=cc(=o)[o-])1) * inchi-key: ** ayfxpgx...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite HMP ==
+
== Metabolite 4-CARBOXYMETHYLENEBUT-2-EN-4-OLIDE ==
 
* common-name:
 
* common-name:
** 4-amino-2-methyl-5-pyrimidinemethanol
+
** cis-dienelactone
 
* smiles:
 
* smiles:
** cc1(n=c(c(=cn=1)co)n)
+
** c1(=cc(=o)oc(=cc(=o)[o-])1)
 
* inchi-key:
 
* inchi-key:
** vutbelpredjddh-uhfffaoysa-n
+
** ayfxpgxazmfwnh-arjawskdsa-m
 
* molecular-weight:
 
* molecular-weight:
** 139.157
+
** 139.087
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[OHMETPYRKIN-RXN]]
+
* [[CARBOXYMETHYLENEBUTENOLIDASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12613]]
 
* [[THIAMINASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-amino-2-methyl-5-pyrimidinemethanol}}
+
{{#set: common-name=cis-dienelactone}}
{{#set: inchi-key=inchikey=vutbelpredjddh-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=ayfxpgxazmfwnh-arjawskdsa-m}}
{{#set: molecular-weight=139.157}}
+
{{#set: molecular-weight=139.087}}

Revision as of 13:09, 14 January 2021

Metabolite 4-CARBOXYMETHYLENEBUT-2-EN-4-OLIDE

  • common-name:
    • cis-dienelactone
  • smiles:
    • c1(=cc(=o)oc(=cc(=o)[o-])1)
  • inchi-key:
    • ayfxpgxazmfwnh-arjawskdsa-m
  • molecular-weight:
    • 139.087

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality