Difference between revisions of "Processed-Mitochondrial-Proteins"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3710 == * common-name: ** cytidine 2'-monophosphate * smiles: ** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)op([o-])([o-])=o)o))o * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite Processed-Mitochondrial-Proteins == * common-name: ** a fully-processed mitochondrial protein == Reaction(s) known to consume the compoun...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Processed-Mitochondrial-Proteins == |
* common-name: | * common-name: | ||
| − | ** | + | ** a fully-processed mitochondrial protein |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[3.4.24.59-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a fully-processed mitochondrial protein}} |
| − | |||
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite Processed-Mitochondrial-Proteins
- common-name:
- a fully-processed mitochondrial protein
