Difference between revisions of "Processed-Mitochondrial-Proteins"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Processed-Mitochondrial-Proteins == * common-name: ** a fully-processed mitochondrial protein == Reaction(s) known to consume the compoun...") |
(Created page with "Category:metabolite == Metabolite SHIKIMATE-5P == * common-name: ** shikimate 3-phosphate * smiles: ** c(=o)([o-])c1(=cc(op(=o)([o-])[o-])c(o)c(o)c1) * inchi-key: ** qyojs...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite SHIKIMATE-5P == |
* common-name: | * common-name: | ||
− | ** | + | ** shikimate 3-phosphate |
+ | * smiles: | ||
+ | ** c(=o)([o-])c1(=cc(op(=o)([o-])[o-])c(o)c(o)c1) | ||
+ | * inchi-key: | ||
+ | ** qyojskgcwnakgw-pbxrrbtrsa-k | ||
+ | * molecular-weight: | ||
+ | ** 251.109 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[2.5.1.19-RXN]] | ||
+ | * [[SHIKIMATE-KINASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[2.5.1.19-RXN]] |
+ | * [[SHIKIMATE-KINASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=shikimate 3-phosphate}} |
+ | {{#set: inchi-key=inchikey=qyojskgcwnakgw-pbxrrbtrsa-k}} | ||
+ | {{#set: molecular-weight=251.109}} |
Revision as of 13:11, 14 January 2021
Contents
Metabolite SHIKIMATE-5P
- common-name:
- shikimate 3-phosphate
- smiles:
- c(=o)([o-])c1(=cc(op(=o)([o-])[o-])c(o)c(o)c1)
- inchi-key:
- qyojskgcwnakgw-pbxrrbtrsa-k
- molecular-weight:
- 251.109