Difference between revisions of "Propionyl-CoA-CO2-ligases"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-665 == * common-name: ** 1-propanal * smiles: ** cc[ch]=o * inchi-key: ** nbbjymsmwiiqgu-uhfffaoysa-n * molecular-weight: ** 58.08 ==...") |
(Created page with "Category:metabolite == Metabolite CPD-9007 == * common-name: ** adp ribose 1'',2''-cyclic phosphate * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op(=o)([o...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-9007 == |
* common-name: | * common-name: | ||
− | ** 1- | + | ** adp ribose 1'',2''-cyclic phosphate |
* smiles: | * smiles: | ||
− | ** | + | ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op(=o)([o-])occ5(c(o)c4(c(op([o-])(=o)o4)o5)))([o-])=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** npspryxpogpcpm-tyasjmozsa-k |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 618.26 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[2.7.1.160-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=1- | + | {{#set: common-name=adp ribose 1'',2''-cyclic phosphate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=npspryxpogpcpm-tyasjmozsa-k}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=618.26}} |
Revision as of 15:27, 5 January 2021
Contents
Metabolite CPD-9007
- common-name:
- adp ribose 1,2-cyclic phosphate
- smiles:
- c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op(=o)([o-])occ5(c(o)c4(c(op([o-])(=o)o4)o5)))([o-])=o
- inchi-key:
- npspryxpogpcpm-tyasjmozsa-k
- molecular-weight:
- 618.26