Difference between revisions of "Protein-Disulfides"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-METHYL-3-HYDROXY-BUTYRYL-COA == * common-name: ** (2s,3s)-3-hydroxy-2-methylbutanoyl-coa * smiles: ** cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)...")
(Created page with "Category:metabolite == Metabolite Protein-Disulfides == * common-name: ** a protein disulfide == Reaction(s) known to consume the compound == * 1.6.4.4-RXN * HDS =...")
 
(4 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2-METHYL-3-HYDROXY-BUTYRYL-COA ==
+
== Metabolite Protein-Disulfides ==
 
* common-name:
 
* common-name:
** (2s,3s)-3-hydroxy-2-methylbutanoyl-coa
+
** a protein disulfide
* smiles:
 
** cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c(c)o
 
* inchi-key:
 
** pekyntfsobaabv-lqudnsjzsa-j
 
* molecular-weight:
 
** 863.619
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.1.1.178-RXN]]
+
* [[1.6.4.4-RXN]]
* [[HMNOS]]
+
* [[HDS]]
* [[TIGLYLCOA-HYDROXY-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.1.1.178-RXN]]
+
* [[1.11.1.15-RXN]]
* [[ECH_LPAREN_3hmbcoa_RPAREN_]]
+
* [[1.6.4.4-RXN]]
* [[HMNOS]]
+
* [[HDS]]
* [[TIGLYLCOA-HYDROXY-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2s,3s)-3-hydroxy-2-methylbutanoyl-coa}}
+
{{#set: common-name=a protein disulfide}}
{{#set: inchi-key=inchikey=pekyntfsobaabv-lqudnsjzsa-j}}
 
{{#set: molecular-weight=863.619}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite Protein-Disulfides

  • common-name:
    • a protein disulfide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality