Difference between revisions of "Protein-Dithiols"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 5-HYDROXYISOURATE == * common-name: ** (s)-5-hydroxyisourate * smiles: ** c2(c1(o)(nc(=o)nc1=nc(=o)n2))(=o) * inchi-key: ** ltqypavlayvkt...") |
(Created page with "Category:metabolite == Metabolite Protein-Dithiols == * common-name: ** a protein dithiol == Reaction(s) known to consume the compound == * 1.6.4.4-RXN * HDS == Re...") |
||
(2 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Protein-Dithiols == |
* common-name: | * common-name: | ||
− | ** | + | ** a protein dithiol |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[1.6.4.4-RXN]] |
+ | * [[HDS]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[1.6.4.4-RXN]] |
+ | * [[HDS]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a protein dithiol}} |
− | |||
− |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite Protein-Dithiols
- common-name:
- a protein dithiol