Difference between revisions of "Protein-GlcNAc-alpha-D-mannosyl-L-Thr"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DUTP == * common-name: ** dutp * smiles: ** c(c2(c(cc(n1(c(nc(c=c1)=o)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o * inchi-key: **...") |
(Created page with "Category:metabolite == Metabolite Protein-GlcNAc-alpha-D-mannosyl-L-Thr == * common-name: ** o2-[n-acetyl-β-d-glucosaminyl-(1→4)-α-d-mannosy]-l-threonyl-[p...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Protein-GlcNAc-alpha-D-mannosyl-L-Thr == |
* common-name: | * common-name: | ||
| − | ** | + | ** o2-[n-acetyl-β-d-glucosaminyl-(1→4)-α-d-mannosy]-l-threonyl-[protein] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-14841]] | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-14841]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=o2-[n-acetyl-β-d-glucosaminyl-(1→4)-α-d-mannosy]-l-threonyl-[protein]}} |
| − | |||
| − | |||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite Protein-GlcNAc-alpha-D-mannosyl-L-Thr
- common-name:
- o2-[n-acetyl-β-d-glucosaminyl-(1→4)-α-d-mannosy]-l-threonyl-[protein]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "o2-[n-acetyl-β-d-glucosaminyl-(1→4)-α-d-mannosy]-l-threonyl-[protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
