Difference between revisions of "Protein-L-Arginines"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite SUMO-propeptides == * common-name: ** a small ubiquitin-like modifier (sumo) propeptide == Reaction(s) known to consume the compound == *...") |
(Created page with "Category:metabolite == Metabolite 13-HYDROPEROXYOCTADECA-911-DIENOATE == * common-name: ** (13s)-hpode * smiles: ** cccccc(c=cc=ccccccccc(=o)[o-])oo * inchi-key: ** jdsrhv...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 13-HYDROPEROXYOCTADECA-911-DIENOATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** (13s)-hpode |
| + | * smiles: | ||
| + | ** cccccc(c=cc=ccccccccc(=o)[o-])oo | ||
| + | * inchi-key: | ||
| + | ** jdsrhvwsamtssn-irqzeampsa-m | ||
| + | * molecular-weight: | ||
| + | ** 311.44 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[LIPOXYGENASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(13s)-hpode}} |
| + | {{#set: inchi-key=inchikey=jdsrhvwsamtssn-irqzeampsa-m}} | ||
| + | {{#set: molecular-weight=311.44}} | ||
Revision as of 11:17, 15 January 2021
Contents
Metabolite 13-HYDROPEROXYOCTADECA-911-DIENOATE
- common-name:
- (13s)-hpode
- smiles:
- cccccc(c=cc=ccccccccc(=o)[o-])oo
- inchi-key:
- jdsrhvwsamtssn-irqzeampsa-m
- molecular-weight:
- 311.44
