Difference between revisions of "Protein-L-Arginines"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 13-HYDROPEROXYOCTADECA-911-DIENOATE == * common-name: ** (13s)-hpode * smiles: ** cccccc(c=cc=ccccccccc(=o)[o-])oo * inchi-key: ** jdsrhv...") |
(Created page with "Category:metabolite == Metabolite tRNA-Containing-N1-MethylAdenine-58 == * common-name: ** an n1-methyladenine58 in trna == Reaction(s) known to consume the compound == ==...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite tRNA-Containing-N1-MethylAdenine-58 == |
* common-name: | * common-name: | ||
| − | ** | + | ** an n1-methyladenine58 in trna |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-12466]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an n1-methyladenine58 in trna}} |
| − | |||
| − | |||
Revision as of 08:29, 15 March 2021
Contents
Metabolite tRNA-Containing-N1-MethylAdenine-58
- common-name:
- an n1-methyladenine58 in trna
