Difference between revisions of "Protein-L-Arginines"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 13-HYDROPEROXYOCTADECA-911-DIENOATE == * common-name: ** (13s)-hpode * smiles: ** cccccc(c=cc=ccccccccc(=o)[o-])oo * inchi-key: ** jdsrhv...") |
(Created page with "Category:metabolite == Metabolite Protein-L-Arginines == * common-name: ** a [protein]-l-arginine == Reaction(s) known to consume the compound == * 2.4.2.31-RXN * PR...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Protein-L-Arginines == |
* common-name: | * common-name: | ||
| − | ** | + | ** a [protein]-l-arginine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[2.4.2.31-RXN]] | ||
| + | * [[PROTEIN-ARGININE-DEIMINASE-RXN]] | ||
| + | * [[RXN-16889]] | ||
| + | * [[RXN-17120]] | ||
| + | * [[RXN-17121]] | ||
| + | * [[RXN8J2-139]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[2.4.2.31-RXN]] |
| + | * [[RXN-17120]] | ||
| + | * [[RXN-17121]] | ||
| + | * [[RXN8J2-139]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a [protein]-l-arginine}} |
| − | |||
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite Protein-L-Arginines
- common-name:
- a [protein]-l-arginine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [protein]-l-arginine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
