Difference between revisions of "Protein-L-Arginines"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GLC-6-P == * common-name: ** β-d-glucose 6-phosphate * smiles: ** c(c1(oc(c(c(c1o)o)o)o))op([o-])([o-])=o * inchi-key: ** nbschqhzls...") |
(Created page with "Category:metabolite == Metabolite Protein-L-Arginines == * common-name: ** a [protein]-l-arginine == Reaction(s) known to consume the compound == * 2.4.2.31-RXN * PR...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Protein-L-Arginines == |
* common-name: | * common-name: | ||
| − | ** | + | ** a [protein]-l-arginine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[2.4.2.31-RXN]] |
| − | * [[ | + | * [[PROTEIN-ARGININE-DEIMINASE-RXN]] |
| − | * [[ | + | * [[RXN-16889]] |
| − | * [[ | + | * [[RXN-17120]] |
| − | * [[ | + | * [[RXN-17121]] |
| − | + | * [[RXN8J2-139]] | |
| − | * [[ | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[2.4.2.31-RXN]] |
| − | * [[ | + | * [[RXN-17120]] |
| − | * [[ | + | * [[RXN-17121]] |
| − | * [[ | + | * [[RXN8J2-139]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a [protein]-l-arginine}} |
| − | |||
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite Protein-L-Arginines
- common-name:
- a [protein]-l-arginine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [protein]-l-arginine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
