Difference between revisions of "Protein-L-Arginines"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7417 == * common-name: ** cis-coumarinic acid-β-d-glucoside * smiles: ** c(c2(oc(oc1(c=cc=cc=1c=cc(=o)[o-]))c(c(c2o)o)o))o * inc...") |
(Created page with "Category:metabolite == Metabolite GLC-6-P == * common-name: ** β-d-glucose 6-phosphate * smiles: ** c(c1(oc(c(c(c1o)o)o)o))op([o-])([o-])=o * inchi-key: ** nbschqhzls...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite GLC-6-P == |
* common-name: | * common-name: | ||
| − | ** | + | ** β-d-glucose 6-phosphate |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c(c1(oc(c(c(c1o)o)o)o))op([o-])([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** nbschqhzlsjfnq-vfuothlcsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 258.121 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[G6PBDH]] |
| + | * [[G6PBDHh]] | ||
| + | * [[G6PI]] | ||
| + | * [[GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN]] | ||
| + | * [[PGIB]] | ||
| + | * [[PGIBh]] | ||
| + | * [[RXN66-579]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[G6PI]] | ||
| + | * [[GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN]] | ||
| + | * [[PGIB]] | ||
| + | * [[PGIBh]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=β-d-glucose 6-phosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=nbschqhzlsjfnq-vfuothlcsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=258.121}} |
Revision as of 13:11, 14 January 2021
Contents
Metabolite GLC-6-P
- common-name:
- β-d-glucose 6-phosphate
- smiles:
- c(c1(oc(c(c(c1o)o)o)o))op([o-])([o-])=o
- inchi-key:
- nbschqhzlsjfnq-vfuothlcsa-l
- molecular-weight:
- 258.121
