Difference between revisions of "Protein-L-Arginines"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GLC-6-P == * common-name: ** β-d-glucose 6-phosphate * smiles: ** c(c1(oc(c(c(c1o)o)o)o))op([o-])([o-])=o * inchi-key: ** nbschqhzls...") |
(Created page with "Category:metabolite == Metabolite SUMO-propeptides == * common-name: ** a small ubiquitin-like modifier (sumo) propeptide == Reaction(s) known to consume the compound == *...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite SUMO-propeptides == |
* common-name: | * common-name: | ||
− | ** | + | ** a small ubiquitin-like modifier (sumo) propeptide |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[3.4.22.68-RXN]] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a small ubiquitin-like modifier (sumo) propeptide}} |
− | |||
− |
Revision as of 18:57, 14 January 2021
Contents
Metabolite SUMO-propeptides
- common-name:
- a small ubiquitin-like modifier (sumo) propeptide