Difference between revisions of "Protein-L-Asparagine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17655 RXN-17655] == * direction: ** left-to-right * common-name: ** cholest-4-en-3-one 26-monoo...")
(Created page with "Category:metabolite == Metabolite CPD-9038 == * common-name: ** precorrin-1 * smiles: ** cc3(c4(=cc5(=c(c(ccc([o-])=o)=c(cc1(=c(ccc([o-])=o)c(cc(=o)[o-])=c(n1)cc2(nc(=c(cc...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17655 RXN-17655] ==
+
== Metabolite CPD-9038 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** cholest-4-en-3-one 26-monooxygenase
+
** precorrin-1
−
== Reaction formula ==
+
* smiles:
−
* 1 [[CHOLESTEROL]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CPD-19070]][c] '''+''' 1 [[NAD]][c] '''+''' 1 [[WATER]][c]
+
** cc3(c4(=cc5(=c(c(ccc([o-])=o)=c(cc1(=c(ccc([o-])=o)c(cc(=o)[o-])=c(n1)cc2(nc(=c(cc([o-])=o)c=2ccc([o-])=o)cc(c3ccc(=o)[o-])=n4)))n5)cc([o-])=o)))(cc([o-])=o)
−
== Gene(s) associated with this reaction  ==
+
* inchi-key:
−
* Gene: [[SJ20106]]
+
** cjlvuwulfkhgfb-nzcajupmsa-f
−
** Category: [[annotation]]
+
* molecular-weight:
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
** 842.768
−
== Pathway(s) ==
+
== Reaction(s) known to consume the compound ==
−
== Reconstruction information  ==
+
* [[RXN-8675]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) known to produce the compound ==
−
== External links  ==
+
* [[UROPORIIIMETHYLTRANSA-RXN]]
−
{{#set: direction=left-to-right}}
+
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=cholest-4-en-3-one 26-monooxygenase}}
+
{{#set: common-name=precorrin-1}}
−
{{#set: nb gene associated=1}}
+
{{#set: inchi-key=inchikey=cjlvuwulfkhgfb-nzcajupmsa-f}}
−
{{#set: nb pathway associated=0}}
+
{{#set: molecular-weight=842.768}}
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:37, 18 December 2020

Metabolite CPD-9038

  • common-name:
    • precorrin-1
  • smiles:
    • cc3(c4(=cc5(=c(c(ccc([o-])=o)=c(cc1(=c(ccc([o-])=o)c(cc(=o)[o-])=c(n1)cc2(nc(=c(cc([o-])=o)c=2ccc([o-])=o)cc(c3ccc(=o)[o-])=n4)))n5)cc([o-])=o)))(cc([o-])=o)
  • inchi-key:
    • cjlvuwulfkhgfb-nzcajupmsa-f
  • molecular-weight:
    • 842.768

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=Protein-L-Asparagine&oldid=48230"