Difference between revisions of "Protein-L-Ser-or-L-Thr-L-Pro"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7088 == * common-name: ** (2r,3s,4s)-leucodelphinidin * smiles: ** c3(c(c2(oc1(=cc(=cc(=c1c(c2o)o)o)o)))=cc(o)=c(c(o)=3)o) * inchi-ke...") |
(Created page with "Category:metabolite == Metabolite Protein-L-Ser-or-L-Thr-L-Pro == * common-name: ** a protein containing an (l-serine/l-threonine)-l-proline motif == Reaction(s) known to...") |
||
| (5 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Protein-L-Ser-or-L-Thr-L-Pro == |
* common-name: | * common-name: | ||
| − | ** ( | + | ** a protein containing an (l-serine/l-threonine)-l-proline motif |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[2.7.11.24-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[2.7.11.24-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=( | + | {{#set: common-name=a protein containing an (l-serine/l-threonine)-l-proline motif}} |
| − | |||
| − | |||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite Protein-L-Ser-or-L-Thr-L-Pro
- common-name:
- a protein containing an (l-serine/l-threonine)-l-proline motif
