Difference between revisions of "Protein-L-Ser-or-L-Thr-L-Pro"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite AMINO-OXOBUT == * common-name: ** l-2-amino-3-oxobutanoate * smiles: ** cc(=o)c([n+])c([o-])=o * inchi-key: ** sauchdkdcuroao-vkhmyheasa-...")
(Created page with "Category:metabolite == Metabolite SOLANESYL-PYROPHOSPHATE == * common-name: ** all-trans-nonaprenyl diphosphate * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite AMINO-OXOBUT ==
+
== Metabolite SOLANESYL-PYROPHOSPHATE ==
 
* common-name:
 
* common-name:
** l-2-amino-3-oxobutanoate
+
** all-trans-nonaprenyl diphosphate
 
* smiles:
 
* smiles:
** cc(=o)c([n+])c([o-])=o
+
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
 
* inchi-key:
 
* inchi-key:
** sauchdkdcuroao-vkhmyheasa-n
+
** ivlbhbftrnviap-meggaxogsa-k
 
* molecular-weight:
 
* molecular-weight:
** 117.104
+
** 788.015
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[AKBLIG-RXN]]
+
* [[RXN-2761]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[THREODEHYD-RXN]]
+
* [[RXN-11486]]
 +
* [[TRANS-OCTAPRENYLTRANSTRANSFERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-2-amino-3-oxobutanoate}}
+
{{#set: common-name=all-trans-nonaprenyl diphosphate}}
{{#set: inchi-key=inchikey=sauchdkdcuroao-vkhmyheasa-n}}
+
{{#set: inchi-key=inchikey=ivlbhbftrnviap-meggaxogsa-k}}
{{#set: molecular-weight=117.104}}
+
{{#set: molecular-weight=788.015}}

Revision as of 18:53, 14 January 2021

Metabolite SOLANESYL-PYROPHOSPHATE

  • common-name:
    • all-trans-nonaprenyl diphosphate
  • smiles:
    • cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
  • inchi-key:
    • ivlbhbftrnviap-meggaxogsa-k
  • molecular-weight:
    • 788.015

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality