Difference between revisions of "Protein-L-Ser-or-L-Thr-P-L-Pro"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15836 == * common-name: ** α-tocotrienol * smiles: ** cc(=cccc(=cccc(=cccc1(c)(oc2(c(cc1)=c(c(=c(c=2c)c)o)c)))c)c)c * inchi-key...") |
(Created page with "Category:metabolite == Metabolite Protein-L-Ser-or-L-Thr-P-L-Pro == * common-name: ** a protein containing a phosphorylated (l-serine/l-threonine)-l-proline motif == React...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Protein-L-Ser-or-L-Thr-P-L-Pro == |
* common-name: | * common-name: | ||
| − | ** | + | ** a protein containing a phosphorylated (l-serine/l-threonine)-l-proline motif |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[2.7.11.24-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[2.7.11.24-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a protein containing a phosphorylated (l-serine/l-threonine)-l-proline motif}} |
| − | |||
| − | |||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite Protein-L-Ser-or-L-Thr-P-L-Pro
- common-name:
- a protein containing a phosphorylated (l-serine/l-threonine)-l-proline motif
