Difference between revisions of "Protein-L-methionine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite TRP == * common-name: ** l-tryptophan * smiles: ** c2(nc1(c=cc=cc=1c(cc([n+])c(=o)[o-])=2)) * inchi-key: ** qivbcdijiajpqs-vifpvbqesa-n *...")
(Created page with "Category:metabolite == Metabolite Protein-L-methionine == * common-name: ** a [protein]-l-methionine == Reaction(s) known to consume the compound == * 1.8.4.12-RXN ==...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite TRP ==
+
== Metabolite Protein-L-methionine ==
 
* common-name:
 
* common-name:
** l-tryptophan
+
** a [protein]-l-methionine
* smiles:
 
** c2(nc1(c=cc=cc=1c(cc([n+])c(=o)[o-])=2))
 
* inchi-key:
 
** qivbcdijiajpqs-vifpvbqesa-n
 
* molecular-weight:
 
** 204.228
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[AROMATIC-L-AMINO-ACID-DECARBOXYLASE-RXN]]
+
* [[1.8.4.12-RXN]]
* [[RXN-8665]]
 
* [[TRYPTOPHAN--TRNA-LIGASE-RXN]]
 
* [[TRYPTOPHAN-2-MONOOXYGENASE-RXN]]
 
* [[TRYPTOPHAN-AMINOTRANSFERASE-RXN]]
 
* [[biomass_rxn]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-2382]]
+
* [[1.8.4.12-RXN]]
* [[TRYPSYN-RXN]]
+
* [[RXN-8668]]
* [[TRYPTOPHAN-AMINOTRANSFERASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-tryptophan}}
+
{{#set: common-name=a [protein]-l-methionine}}
{{#set: inchi-key=inchikey=qivbcdijiajpqs-vifpvbqesa-n}}
 
{{#set: molecular-weight=204.228}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite Protein-L-methionine

  • common-name:
    • a [protein]-l-methionine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [protein]-l-methionine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.