Difference between revisions of "Protein-L-methionine"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite TRP == * common-name: ** l-tryptophan * smiles: ** c2(nc1(c=cc=cc=1c(cc([n+])c(=o)[o-])=2)) * inchi-key: ** qivbcdijiajpqs-vifpvbqesa-n *...") |
(Created page with "Category:metabolite == Metabolite Protein-L-methionine == * common-name: ** a [protein]-l-methionine == Reaction(s) known to consume the compound == * 1.8.4.12-RXN ==...") |
||
(3 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Protein-L-methionine == |
* common-name: | * common-name: | ||
− | ** | + | ** a [protein]-l-methionine |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[1.8.4.12-RXN]] |
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[1.8.4.12-RXN]] |
− | * [[ | + | * [[RXN-8668]] |
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=l- | + | {{#set: common-name=a [protein]-l-methionine}} |
− | |||
− |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite Protein-L-methionine
- common-name:
- a [protein]-l-methionine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [protein]-l-methionine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.