Difference between revisions of "Protein-L-methionine-S-S-oxides"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite S-ADENOSYLMETHIONINAMINE == * common-name: ** s-adenosyl 3-(methylthio)propylamine * smiles: ** c[s+](ccc[n+])cc1(oc(c(o)c(o)1)n3(c=nc2(=...")
(Created page with "Category:metabolite == Metabolite Protein-L-methionine-S-S-oxides == * common-name: ** a protein-l-methionine-(s)-s-oxide == Reaction(s) known to consume the compound == *...")
 
(2 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite S-ADENOSYLMETHIONINAMINE ==
+
== Metabolite Protein-L-methionine-S-S-oxides ==
 
* common-name:
 
* common-name:
** s-adenosyl 3-(methylthio)propylamine
+
** a protein-l-methionine-(s)-s-oxide
* smiles:
 
** c[s+](ccc[n+])cc1(oc(c(o)c(o)1)n3(c=nc2(=c(n)n=cn=c23)))
 
* inchi-key:
 
** zunbitixdcpnsd-lsrjevitsa-o
 
* molecular-weight:
 
** 356.442
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[APAPT]]
+
* [[RXN-8668]]
* [[RXN-11190]]
 
* [[RXN0-5217]]
 
* [[SPERMIDINESYN-RXN]]
 
* [[SPERMINE-SYNTHASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[AMCL]]
 
* [[RXN-11190]]
 
* [[SAMDECARB-RXN]]
 
* [[SPERMIDINESYN-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=s-adenosyl 3-(methylthio)propylamine}}
+
{{#set: common-name=a protein-l-methionine-(s)-s-oxide}}
{{#set: inchi-key=inchikey=zunbitixdcpnsd-lsrjevitsa-o}}
 
{{#set: molecular-weight=356.442}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite Protein-L-methionine-S-S-oxides

  • common-name:
    • a protein-l-methionine-(s)-s-oxide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality