Difference between revisions of "Protein-L-serine-or-L-threonine"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite O-Long-Chain-Acyl-L-Carnitines == * common-name: ** an o-long-chain-acyl-l-carnitine == Reaction(s) known to consume the compound == * ...") |
(Created page with "Category:metabolite == Metabolite DEOXYADENOSINE == * common-name: ** 2'-deoxyadenosine * smiles: ** c(o)c1(oc(cc(o)1)n3(c=nc2(=c(n)n=cn=c23))) * inchi-key: ** olxzpdwkrny...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite DEOXYADENOSINE == |
* common-name: | * common-name: | ||
− | ** | + | ** 2'-deoxyadenosine |
+ | * smiles: | ||
+ | ** c(o)c1(oc(cc(o)1)n3(c=nc2(=c(n)n=cn=c23))) | ||
+ | * inchi-key: | ||
+ | ** olxzpdwkrnyjjz-rrkcrqdmsa-n | ||
+ | * molecular-weight: | ||
+ | ** 251.244 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[ADDALT-RXN]] |
+ | * [[DAMPH]] | ||
+ | * [[DEOXYADENPHOSPHOR-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[DAMPH]] |
+ | * [[DEOXYADENPHOSPHOR-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=2'-deoxyadenosine}} |
+ | {{#set: inchi-key=inchikey=olxzpdwkrnyjjz-rrkcrqdmsa-n}} | ||
+ | {{#set: molecular-weight=251.244}} |
Revision as of 08:27, 15 March 2021
Contents
Metabolite DEOXYADENOSINE
- common-name:
- 2'-deoxyadenosine
- smiles:
- c(o)c1(oc(cc(o)1)n3(c=nc2(=c(n)n=cn=c23)))
- inchi-key:
- olxzpdwkrnyjjz-rrkcrqdmsa-n
- molecular-weight:
- 251.244