Difference between revisions of "Protein-L-serines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15657 == * common-name: ** (3r)-hydroxy-undecanoyl-coa * smiles: ** ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1...")
(Created page with "Category:metabolite == Metabolite Protein-L-serines == * common-name: ** a [protein]-l-serine == Reaction(s) known to consume the compound == * 2.4.1.221-RXN * 2.4.2...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15657 ==
+
== Metabolite Protein-L-serines ==
 
* common-name:
 
* common-name:
** (3r)-hydroxy-undecanoyl-coa
+
** a [protein]-l-serine
* smiles:
 
** ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** jiogxinzsoqege-mawalykisa-j
 
* molecular-weight:
 
** 947.78
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[2.4.1.221-RXN]]
 +
* [[2.4.2.26-RXN]]
 +
* [[2.7.12.1-RXN]]
 +
* [[RXN-11889]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14778]]
+
* [[2.4.1.221-RXN]]
 +
* [[2.7.12.1-RXN]]
 +
* [[RXN-11889]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(3r)-hydroxy-undecanoyl-coa}}
+
{{#set: common-name=a [protein]-l-serine}}
{{#set: inchi-key=inchikey=jiogxinzsoqege-mawalykisa-j}}
 
{{#set: molecular-weight=947.78}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite Protein-L-serines

  • common-name:
    • a [protein]-l-serine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [protein]-l-serine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.