Difference between revisions of "Protein-N-acetyl-D-glucosamine-L-thr"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-6993 == * common-name: ** pinocembrin chalcone * smiles: ** c2(c=cc(c=cc(c1(=c(c=c(c=c(o)1)o)o))=o)=cc=2) * inchi-key: ** loyxtwzxlwh...")
(Created page with "Category:metabolite == Metabolite Protein-N-acetyl-D-glucosamine-L-thr == * common-name: ** an n-acetyl-β-d-glucosaminyl-l-threonine-[glycoprotein] == Reaction(s) kno...")
 
(5 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-6993 ==
+
== Metabolite Protein-N-acetyl-D-glucosamine-L-thr ==
 
* common-name:
 
* common-name:
** pinocembrin chalcone
+
** an n-acetyl-β-d-glucosaminyl-l-threonine-[glycoprotein]
* smiles:
 
** c2(c=cc(c=cc(c1(=c(c=c(c=c(o)1)o)o))=o)=cc=2)
 
* inchi-key:
 
** loyxtwzxlwhmbx-votsokgwsa-n
 
* molecular-weight:
 
** 256.257
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7647]]
+
* [[RXN-11890]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7645]]
+
* [[RXN-11890]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=pinocembrin chalcone}}
+
{{#set: common-name=an n-acetyl-β-d-glucosaminyl-l-threonine-[glycoprotein]}}
{{#set: inchi-key=inchikey=loyxtwzxlwhmbx-votsokgwsa-n}}
 
{{#set: molecular-weight=256.257}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite Protein-N-acetyl-D-glucosamine-L-thr

  • common-name:
    • an n-acetyl-β-d-glucosaminyl-l-threonine-[glycoprotein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an n-acetyl-β-d-glucosaminyl-l-threonine-[glycoprotein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.