Difference between revisions of "Protein-N-omega-methyl-arginine"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite THIAMINE == * common-name: ** thiamine * smiles: ** cc1([n+](=csc(cco)=1)cc2(c=nc(c)=nc(n)=2)) * inchi-key: ** jzrwcgzrtzmzeh-uhfffaoysa-...") |
(Created page with "Category:metabolite == Metabolite Protein-N-omega-methyl-arginine == * common-name: ** [protein]-nω-methyl-l-arginine == Reaction(s) known to consume the compound ==...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Protein-N-omega-methyl-arginine == |
* common-name: | * common-name: | ||
| − | ** | + | ** [protein]-nω-methyl-l-arginine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-16891]] |
| − | * [[ | + | * [[RXN-16892]] |
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-16889]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=[protein]-nω-methyl-l-arginine}} |
| − | |||
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite Protein-N-omega-methyl-arginine
- common-name:
- [protein]-nω-methyl-l-arginine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "protein]-nω-methyl-l-arginine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
