Difference between revisions of "Protein-N-terminal-L-Arginine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19172 == * common-name: ** (2e,9z)-octadecenoyl-coa * smiles: ** ccccccccc=ccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(o...")
(Created page with "Category:metabolite == Metabolite Protein-N-terminal-L-Arginine == * common-name: ** an n-terminal arginyl-[protein] == Reaction(s) known to consume the compound == == Rea...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-19172 ==
+
== Metabolite Protein-N-terminal-L-Arginine ==
 
* common-name:
 
* common-name:
** (2e,9z)-octadecenoyl-coa
+
** an n-terminal arginyl-[protein]
* smiles:
 
** ccccccccc=ccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** reoymonhghuley-ppsvnwdxsa-j
 
* molecular-weight:
 
** 1025.937
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17776]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17775]]
+
* [[ARGINYLTRANSFERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2e,9z)-octadecenoyl-coa}}
+
{{#set: common-name=an n-terminal arginyl-[protein]}}
{{#set: inchi-key=inchikey=reoymonhghuley-ppsvnwdxsa-j}}
 
{{#set: molecular-weight=1025.937}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite Protein-N-terminal-L-Arginine

  • common-name:
    • an n-terminal arginyl-[protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an n-terminal arginyl-[protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.