Difference between revisions of "Protein-Red-Disulfides"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GUANINE == * common-name: ** guanine * smiles: ** c2(=nc1(=c(n=c(nc(=o)1)n)n2)) * inchi-key: ** uytpupdqbnuygx-uhfffaoysa-n * molecular-w...") |
(Created page with "Category:metabolite == Metabolite Protein-Red-Disulfides == * common-name: ** a protein with reduced sulfide groups == Reaction(s) known to consume the compound == * DIS...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Protein-Red-Disulfides == |
* common-name: | * common-name: | ||
| − | ** | + | ** a protein with reduced sulfide groups |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[DISULFOXRED-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[DISULFOXRED-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a protein with reduced sulfide groups}} |
| − | |||
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite Protein-Red-Disulfides
- common-name:
- a protein with reduced sulfide groups
