Difference between revisions of "Protein-S-farnesyl-L-cysteines"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-786 == * common-name: ** (4z)-2-oxohept-4-enedioate * smiles: ** c(ccc=cc(c([o-])=o)=o)([o-])=o * inchi-key: ** hyvszvzmtyihkf-iwqzzh...") |
(Created page with "Category:metabolite == Metabolite CPD-8625 == * common-name: ** a [protein]-l-proline (ω = 0) == Reaction(s) known to consume the compound == * PEPTIDYLPROLYL-ISOM...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-8625 == |
* common-name: | * common-name: | ||
− | ** | + | ** a [protein]-l-proline (ω = 0) |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[PEPTIDYLPROLYL-ISOMERASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[PEPTIDYLPROLYL-ISOMERASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a [protein]-l-proline (ω = 0)}} |
− | |||
− |
Revision as of 08:24, 15 March 2021
Contents
Metabolite CPD-8625
- common-name:
- a [protein]-l-proline (ω = 0)
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [protein]-l-proline (ω = 0)" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.