Difference between revisions of "Protein-S-farnesyl-L-cysteines"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-786 == * common-name: ** (4z)-2-oxohept-4-enedioate * smiles: ** c(ccc=cc(c([o-])=o)=o)([o-])=o * inchi-key: ** hyvszvzmtyihkf-iwqzzh...") |
(Created page with "Category:metabolite == Metabolite Protein-S-farnesyl-L-cysteines == * common-name: ** a [protein] s-farnesyl-l-cysteine == Reaction(s) known to consume the compound == * [...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Protein-S-farnesyl-L-cysteines == |
* common-name: | * common-name: | ||
| − | ** | + | ** a [protein] s-farnesyl-l-cysteine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[2.5.1.58-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[2.5.1.58-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a [protein] s-farnesyl-l-cysteine}} |
| − | |||
| − | |||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite Protein-S-farnesyl-L-cysteines
- common-name:
- a [protein] s-farnesyl-l-cysteine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [protein] s-farnesyl-l-cysteine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
