Difference between revisions of "Protein-Ser-or-Thr-phosphate"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7279 == * common-name: ** 2-cis,4-trans-xanthoxin * smiles: ** cc(c=cc12(c(cc(cc1(c)o2)o)(c)c))=cc=o * inchi-key: ** ztalkmxohwqnia-t...") |
(Created page with "Category:metabolite == Metabolite Protein-Ser-or-Thr-phosphate == * common-name: ** a [protein] (l-serine/l-threonine) phosphate == Reaction(s) known to consume the compou...") |
||
| (2 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Protein-Ser-or-Thr-phosphate == |
* common-name: | * common-name: | ||
| − | ** | + | ** a [protein] (l-serine/l-threonine) phosphate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[3.1.3.16-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[PROTEIN-KINASE-RXN]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a [protein] (l-serine/l-threonine) phosphate}} |
| − | |||
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite Protein-Ser-or-Thr-phosphate
- common-name:
- a [protein] (l-serine/l-threonine) phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [protein] (l-serine/l-threonine) phosphate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
