Difference between revisions of "Protein-With-N-Terminal-Met"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13473 == * common-name: ** 3-(4-deoxy-β-d-gluc-4-enuronosyl)-n-acetyl-d-glucosamine * smiles: ** cc(=o)nc2(c(o)oc(co)c(o)c(oc1(o...")
(Created page with "Category:metabolite == Metabolite Protein-With-N-Terminal-Met == * common-name: ** a peptide with an n-terminal l-methionine == Reaction(s) known to consume the compound =...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-13473 ==
+
== Metabolite Protein-With-N-Terminal-Met ==
 
* common-name:
 
* common-name:
** 3-(4-deoxy-β-d-gluc-4-enuronosyl)-n-acetyl-d-glucosamine
+
** a peptide with an n-terminal l-methionine
* smiles:
 
** cc(=o)nc2(c(o)oc(co)c(o)c(oc1(oc(c([o-])=o)=cc(o)c(o)1))2)
 
* inchi-key:
 
** dlgjwsvwtwewbj-zdlrkiohsa-m
 
* molecular-weight:
 
** 378.312
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16485]]
+
* [[3.4.11.18-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-(4-deoxy-β-d-gluc-4-enuronosyl)-n-acetyl-d-glucosamine}}
+
{{#set: common-name=a peptide with an n-terminal l-methionine}}
{{#set: inchi-key=inchikey=dlgjwsvwtwewbj-zdlrkiohsa-m}}
 
{{#set: molecular-weight=378.312}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite Protein-With-N-Terminal-Met

  • common-name:
    • a peptide with an n-terminal l-methionine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality