Difference between revisions of "Protein-phospho-fructosamines"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite trans-D2-cis-cis-D17-35-C54-3-ACPs == * common-name: ** a trans-delta2-cis,cis-delta17,35-c54:3-[acp] == Reaction(s) known to consume the...") |
(Created page with "Category:metabolite == Metabolite CPD-18532 == * common-name: ** (r)-β-hydroxy-l-kynurenine * smiles: ** c([o-])(=o)c([n+])c(o)c(=o)c1(=c(n)c=cc=c1) * inchi-key: ** m...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-18532 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (r)-β-hydroxy-l-kynurenine |
| + | * smiles: | ||
| + | ** c([o-])(=o)c([n+])c(o)c(=o)c1(=c(n)c=cc=c1) | ||
| + | * inchi-key: | ||
| + | ** memllrtvgbiljw-ionnqarksa-n | ||
| + | * molecular-weight: | ||
| + | ** 224.216 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-17150]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(r)-β-hydroxy-l-kynurenine}} |
| + | {{#set: inchi-key=inchikey=memllrtvgbiljw-ionnqarksa-n}} | ||
| + | {{#set: molecular-weight=224.216}} | ||
Revision as of 14:54, 5 January 2021
Contents
Metabolite CPD-18532
- common-name:
- (r)-β-hydroxy-l-kynurenine
- smiles:
- c([o-])(=o)c([n+])c(o)c(=o)c1(=c(n)c=cc=c1)
- inchi-key:
- memllrtvgbiljw-ionnqarksa-n
- molecular-weight:
- 224.216
