Difference between revisions of "Protein-pi-phospho-L-histidines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3709 == * common-name: ** guanosine 2',3'-cyclic monophosphate * smiles: ** c(o)c2(oc(c1(op([o-])(=o)oc12))n4(c=nc3(c(=o)nc(n)=nc=34)...")
(Created page with "Category:metabolite == Metabolite Protein-pi-phospho-L-histidines == * common-name: ** a [protein]-nπ-phospho-l-histidine == Reaction(s) known to consume the compound =...")
 
(4 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-3709 ==
+
== Metabolite Protein-pi-phospho-L-histidines ==
 
* common-name:
 
* common-name:
** guanosine 2',3'-cyclic monophosphate
+
** a [protein]-nπ-phospho-l-histidine
* smiles:
 
** c(o)c2(oc(c1(op([o-])(=o)oc12))n4(c=nc3(c(=o)nc(n)=nc=34)))
 
* inchi-key:
 
** uasryodfrywbrc-uuokfmhzsa-m
 
* molecular-weight:
 
** 344.2
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12058]]
+
* [[RXN-15509]]
 +
* [[RXN-15510]]
 +
* [[RXN-15511]]
 +
* [[RXN-15512]]
 +
* [[RXN-17131]]
 +
* [[RXN-17276]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-15509]]
 +
* [[RXN-15510]]
 +
* [[RXN-15511]]
 +
* [[RXN-15512]]
 +
* [[RXN-17274]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=guanosine 2',3'-cyclic monophosphate}}
+
{{#set: common-name=a [protein]-nπ-phospho-l-histidine}}
{{#set: inchi-key=inchikey=uasryodfrywbrc-uuokfmhzsa-m}}
 
{{#set: molecular-weight=344.2}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite Protein-pi-phospho-L-histidines

  • common-name:
    • a [protein]-nπ-phospho-l-histidine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [protein]-nπ-phospho-l-histidine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.