Difference between revisions of "Protein-pi-phospho-L-histidines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3709 == * common-name: ** guanosine 2',3'-cyclic monophosphate * smiles: ** c(o)c2(oc(c1(op([o-])(=o)oc12))n4(c=nc3(c(=o)nc(n)=nc=34)...")
(Created page with "Category:metabolite == Metabolite Guanine34-in-tRNAs == * common-name: ** a guanine34 in trna == Reaction(s) known to consume the compound == * QUEUOSINE-TRNA-RIBOSYLTRA...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-3709 ==
+
== Metabolite Guanine34-in-tRNAs ==
 
* common-name:
 
* common-name:
** guanosine 2',3'-cyclic monophosphate
+
** a guanine34 in trna
* smiles:
 
** c(o)c2(oc(c1(op([o-])(=o)oc12))n4(c=nc3(c(=o)nc(n)=nc=34)))
 
* inchi-key:
 
** uasryodfrywbrc-uuokfmhzsa-m
 
* molecular-weight:
 
** 344.2
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12058]]
+
* [[QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN]]
 +
* [[RXN0-1321]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=guanosine 2',3'-cyclic monophosphate}}
+
{{#set: common-name=a guanine34 in trna}}
{{#set: inchi-key=inchikey=uasryodfrywbrc-uuokfmhzsa-m}}
 
{{#set: molecular-weight=344.2}}
 

Revision as of 13:10, 14 January 2021

Metabolite Guanine34-in-tRNAs

  • common-name:
    • a guanine34 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality