Difference between revisions of "Protein-tyrosine-phosphates"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8082 == * common-name: ** 1-18:2-2-18:2-digalactosyldiacylglycerol * smiles: ** cccccc=ccc=ccccccccc(occ(coc2(oc(coc1(oc(co)c(o)c(o)c...")
(Created page with "Category:metabolite == Metabolite Protein-tyrosine-phosphates == * common-name: ** a [protein]-l-tyrosine phosphate == Reaction(s) known to consume the compound == * PRO...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8082 ==
+
== Metabolite Protein-tyrosine-phosphates ==
 
* common-name:
 
* common-name:
** 1-18:2-2-18:2-digalactosyldiacylglycerol
+
** a [protein]-l-tyrosine phosphate
* smiles:
 
** cccccc=ccc=ccccccccc(occ(coc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))oc(=o)cccccccc=ccc=cccccc)=o
 
* inchi-key:
 
** muubilnsvlplll-mezujybgsa-n
 
* molecular-weight:
 
** 941.247
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8310]]
+
* [[PROTEIN-TYROSINE-PHOSPHATASE-RXN]]
* [[RXN-8313]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[2.7.10.1-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-18:2-2-18:2-digalactosyldiacylglycerol}}
+
{{#set: common-name=a [protein]-l-tyrosine phosphate}}
{{#set: inchi-key=inchikey=muubilnsvlplll-mezujybgsa-n}}
 
{{#set: molecular-weight=941.247}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite Protein-tyrosine-phosphates

  • common-name:
    • a [protein]-l-tyrosine phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [protein]-l-tyrosine phosphate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.