Difference between revisions of "Protein-tyrosine-phosphates"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite holo-Transcarboxylases == * common-name: ** a holo-[methylmalonyl-coa:pyruvate carboxytransferase] == Reaction(s) known to consume the co...")
(Created page with "Category:metabolite == Metabolite IMP == * common-name: ** imp * smiles: ** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23))) * inchi-key: ** grszfwquakgdav-kqy...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite holo-Transcarboxylases ==
+
== Metabolite IMP ==
 
* common-name:
 
* common-name:
** a holo-[methylmalonyl-coa:pyruvate carboxytransferase]
+
** imp
 +
* smiles:
 +
** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23)))
 +
* inchi-key:
 +
** grszfwquakgdav-kqynxxcusa-l
 +
* molecular-weight:
 +
** 346.193
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[ADENYLOSUCCINATE-SYNTHASE-RXN]]
 +
* [[HPRT]]
 +
* [[I5NT]]
 +
* [[IMP-DEHYDROG-RXN]]
 +
* [[IMPCYCLOHYDROLASE-RXN]]
 +
* [[RXN-7607]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[6.3.4.9-RXN]]
+
* [[AMP-DEAMINASE-RXN]]
 +
* [[GMP-REDUCT-RXN]]
 +
* [[HPRT]]
 +
* [[HYPOXANPRIBOSYLTRAN-RXN]]
 +
* [[IMP-DEHYDROG-RXN]]
 +
* [[IMPCYCLOHYDROLASE-RXN]]
 +
* [[ITPP]]
 +
* [[RXN-14003]]
 +
* [[RXN0-6382]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a holo-[methylmalonyl-coa:pyruvate carboxytransferase]}}
+
{{#set: common-name=imp}}
 +
{{#set: inchi-key=inchikey=grszfwquakgdav-kqynxxcusa-l}}
 +
{{#set: molecular-weight=346.193}}

Revision as of 18:53, 14 January 2021

Metabolite IMP

  • common-name:
    • imp
  • smiles:
    • c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23)))
  • inchi-key:
    • grszfwquakgdav-kqynxxcusa-l
  • molecular-weight:
    • 346.193

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality